C16H22N4S — CID 103379473
5-[4-(dimethylamino)piperidin-1-yl]-4-phenyl-1,2-thiazol-3-amine (PubChem CID 103379473) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 5-[4-(dimethylamino)piperidin-1-yl]-4-phenyl-1,2-thiazol-3-amine.
| Compound Name | 5-[4-(dimethylamino)piperidin-1-yl]-4-phenyl-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103379473 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 5-[4-(dimethylamino)piperidin-1-yl]-4-phenyl-1,2-thiazol-3-amine |
| SMILES | CN(C)C1CCN(c2snc(N)c2-c2ccccc2)CC1 |
| InChI | InChI=1S/C16H22N4S/c1-19(2)13-8-10-20(11-9-13)16-14(15(17)18-21-16)12-6-4-3-5-7-12/h3-7,13H,8-11H2,1-2H3,(H2,17,18) |
| InChIKey | IITRSZTZYFVLLI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |