C16H21N3OS — CID 107229416
2-[1-(3-amino-4-phenyl-1,2-thiazol-5-yl)piperidin-3-yl]ethanol (PubChem CID 107229416) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-[1-(3-amino-4-phenyl-1,2-thiazol-5-yl)piperidin-3-yl]ethanol.
| Compound Name | 2-[1-(3-amino-4-phenyl-1,2-thiazol-5-yl)piperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 107229416 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[1-(3-amino-4-phenyl-1,2-thiazol-5-yl)piperidin-3-yl]ethanol |
| SMILES | Nc1nsc(N2CCCC(CCO)C2)c1-c1ccccc1 |
| InChI | InChI=1S/C16H21N3OS/c17-15-14(13-6-2-1-3-7-13)16(21-18-15)19-9-4-5-12(11-19)8-10-20/h1-3,6-7,12,20H,4-5,8-11H2,(H2,17,18) |
| InChIKey | VIBOJDHDJMAIPN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |