C15H19N3S — CID 103381127
5-(azepan-1-yl)-4-phenyl-1,2-thiazol-3-amine (PubChem CID 103381127) has the molecular formula C15H19N3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 5-(azepan-1-yl)-4-phenyl-1,2-thiazol-3-amine.
| Compound Name | 5-(azepan-1-yl)-4-phenyl-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103381127 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 5-(azepan-1-yl)-4-phenyl-1,2-thiazol-3-amine |
| SMILES | Nc1nsc(N2CCCCCC2)c1-c1ccccc1 |
| InChI | InChI=1S/C15H19N3S/c16-14-13(12-8-4-3-5-9-12)15(19-17-14)18-10-6-1-2-7-11-18/h3-5,8-9H,1-2,6-7,10-11H2,(H2,16,17) |
| InChIKey | JSLXOGCQTPGBKD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |