C12H20N4OS — CID 103383271
4-methoxy-5-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,2-thiazol-3-amine (PubChem CID 103383271) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 4-methoxy-5-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,2-thiazol-3-amine.
| Compound Name | 4-methoxy-5-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103383271 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-methoxy-5-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-1,2-thiazol-3-amine |
| SMILES | COc1c(N)nsc1N1CC2CCCN2CC1C |
| InChI | InChI=1S/C12H20N4OS/c1-8-6-15-5-3-4-9(15)7-16(8)12-10(17-2)11(13)14-18-12/h8-9H,3-7H2,1-2H3,(H2,13,14) |
| InChIKey | VXXIOAZKZXDUMQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |