About 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine
4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine (PubChem CID 103384673) has the molecular formula C9H15N3OS2
and a molecular weight of 245.37 g/mol. Its IUPAC name is 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine.
Molecular Properties
| Compound Name | 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine |
| PubChem CID | 103384673 |
| Molecular Formula | C9H15N3OS2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine |
| SMILES | COc1c(N)nsc1N1CCSC(C)C1 |
| InChI | InChI=1S/C9H15N3OS2/c1-6-5-12(3-4-14-6)9-7(13-2)8(10)11-15-9/h6H,3-5H2,1-2H3,(H2,10,11) |
| InChIKey | OYTBPVQEAFXWLI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine?
The IUPAC name of 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine (CID 103384673) is 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine.
What is the SMILES notation for 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine?
The canonical SMILES for 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine is COc1c(N)nsc1N1CCSC(C)C1.
What is the InChIKey of 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine?
The InChIKey is OYTBPVQEAFXWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3OS2/c1-6-5-12(3-4-14-6)9-7(13-2)8(10)11-15-9/h6H,3-5H2,1-2H3,(H2,10,11).
What are the key properties of 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine?
4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine has a molecular weight of 245.37 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-5-(2-methylthiomorpholin-4-yl)-1,2-thiazol-3-amine is sourced from PubChem (CID 103384673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).