C18H34N2O — CID 103387014
4-N-[1-(1-adamantyl)ethyl]-5-methoxypentane-1,4-diamine (PubChem CID 103387014) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is 4-N-[1-(1-adamantyl)ethyl]-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-[1-(1-adamantyl)ethyl]-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103387014 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 4-N-[1-(1-adamantyl)ethyl]-5-methoxypentane-1,4-diamine |
| SMILES | COCC(CCCN)NC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H34N2O/c1-13(20-17(12-21-2)4-3-5-19)18-9-14-6-15(10-18)8-16(7-14)11-18/h13-17,20H,3-12,19H2,1-2H3 |
| InChIKey | CBJVXTKNNWMESH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |