C11H26N2O — CID 103387026
5-methoxy-4-N-pentan-2-ylpentane-1,4-diamine (PubChem CID 103387026) has the molecular formula C11H26N2O and a molecular weight of 202.34 g/mol. Its IUPAC name is 5-methoxy-4-N-pentan-2-ylpentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-pentan-2-ylpentane-1,4-diamine |
|---|---|
| PubChem CID | 103387026 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | 5-methoxy-4-N-pentan-2-ylpentane-1,4-diamine |
| SMILES | CCCC(C)NC(CCCN)COC |
| InChI | InChI=1S/C11H26N2O/c1-4-6-10(2)13-11(9-14-3)7-5-8-12/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | SSCYTBBADGXPEJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |