C12H28N2O — CID 103389536
5-methoxy-4-N-(3-methylpentan-2-yl)pentane-1,4-diamine (PubChem CID 103389536) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is 5-methoxy-4-N-(3-methylpentan-2-yl)pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-(3-methylpentan-2-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 103389536 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | 5-methoxy-4-N-(3-methylpentan-2-yl)pentane-1,4-diamine |
| SMILES | CCC(C)C(C)NC(CCCN)COC |
| InChI | InChI=1S/C12H28N2O/c1-5-10(2)11(3)14-12(9-15-4)7-6-8-13/h10-12,14H,5-9,13H2,1-4H3 |
| InChIKey | SRURYULOBUJJCC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |