C16H32N4O3 — CID 103388270
tert-butyl N-[2-[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]propyl]carbamate (PubChem CID 103388270) has the molecular formula C16H32N4O3 and a molecular weight of 328.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 103388270 |
| Molecular Formula | C16H32N4O3 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | tert-butyl N-[2-[[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]amino]propyl]carbamate |
| SMILES | CNC(=O)CN1CCC(NC(C)CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32N4O3/c1-12(10-18-15(22)23-16(2,3)4)19-13-6-8-20(9-7-13)11-14(21)17-5/h12-13,19H,6-11H2,1-5H3,(H,17,21)(H,18,22) |
| InChIKey | IKNOAKIDEPRXEB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |