C10H19N3OS — CID 103389503
5-methoxy-4-N-(1,3-thiazol-2-ylmethyl)pentane-1,4-diamine (PubChem CID 103389503) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is 5-methoxy-4-N-(1,3-thiazol-2-ylmethyl)pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-(1,3-thiazol-2-ylmethyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 103389503 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 5-methoxy-4-N-(1,3-thiazol-2-ylmethyl)pentane-1,4-diamine |
| SMILES | COCC(CCCN)NCc1nccs1 |
| InChI | InChI=1S/C10H19N3OS/c1-14-8-9(3-2-4-11)13-7-10-12-5-6-15-10/h5-6,9,13H,2-4,7-8,11H2,1H3 |
| InChIKey | QKTRBCMLGNKHHN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |