C10H14N2S — CID 115654848
N-(1,3-thiazol-2-ylmethyl)hex-5-yn-3-amine (PubChem CID 115654848) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is N-(1,3-thiazol-2-ylmethyl)hex-5-yn-3-amine.
| Compound Name | N-(1,3-thiazol-2-ylmethyl)hex-5-yn-3-amine |
|---|---|
| PubChem CID | 115654848 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | N-(1,3-thiazol-2-ylmethyl)hex-5-yn-3-amine |
| SMILES | C#CCC(CC)NCc1nccs1 |
| InChI | InChI=1S/C10H14N2S/c1-3-5-9(4-2)12-8-10-11-6-7-13-10/h1,6-7,9,12H,4-5,8H2,2H3 |
| InChIKey | IOXKSZSNXAIKNO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|