About N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine
N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine (PubChem CID 115654801) has the molecular formula C15H17N3S
and a molecular weight of 271.39 g/mol. Its IUPAC name is N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine.
Molecular Properties
| Compound Name | N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine |
| PubChem CID | 115654801 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine |
| SMILES | C#CCC(CC)NCc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C15H17N3S/c1-3-7-12(4-2)17-10-13-11-19-15(18-13)14-8-5-6-9-16-14/h1,5-6,8-9,11-12,17H,4,7,10H2,2H3 |
| InChIKey | ZHZYEYRWJBVGGD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine?
The IUPAC name of N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine (CID 115654801) is N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine.
What is the SMILES notation for N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine?
The canonical SMILES for N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine is C#CCC(CC)NCc1csc(-c2ccccn2)n1.
What is the InChIKey of N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine?
The InChIKey is ZHZYEYRWJBVGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3S/c1-3-7-12(4-2)17-10-13-11-19-15(18-13)14-8-5-6-9-16-14/h1,5-6,8-9,11-12,17H,4,7,10H2,2H3.
What are the key properties of N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine?
N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine has a molecular weight of 271.39 g/mol, XLogP of 3.10, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine is sourced from PubChem (CID 115654801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).