C15H17N3S — CID 115654801
N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine (PubChem CID 115654801) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine.
| Compound Name | N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine |
|---|---|
| PubChem CID | 115654801 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]hex-5-yn-3-amine |
| SMILES | C#CCC(CC)NCc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C15H17N3S/c1-3-7-12(4-2)17-10-13-11-19-15(18-13)14-8-5-6-9-16-14/h1,5-6,8-9,11-12,17H,4,7,10H2,2H3 |
| InChIKey | ZHZYEYRWJBVGGD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|