C10H20N4O — CID 103389358
5-methoxy-4-N-(1H-pyrazol-4-ylmethyl)pentane-1,4-diamine (PubChem CID 103389358) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is 5-methoxy-4-N-(1H-pyrazol-4-ylmethyl)pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-(1H-pyrazol-4-ylmethyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 103389358 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 5-methoxy-4-N-(1H-pyrazol-4-ylmethyl)pentane-1,4-diamine |
| SMILES | COCC(CCCN)NCc1cn[nH]c1 |
| InChI | InChI=1S/C10H20N4O/c1-15-8-10(3-2-4-11)12-5-9-6-13-14-7-9/h6-7,10,12H,2-5,8,11H2,1H3,(H,13,14) |
| InChIKey | ZLYUSNCWWPAGOG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |