C12H21N3O4 — CID 103391276
5-amino-2-(3,5-dimethoxypyrazin-2-yl)-1-methoxypentan-2-ol (PubChem CID 103391276) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-amino-2-(3,5-dimethoxypyrazin-2-yl)-1-methoxypentan-2-ol.
| Compound Name | 5-amino-2-(3,5-dimethoxypyrazin-2-yl)-1-methoxypentan-2-ol |
|---|---|
| PubChem CID | 103391276 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 5-amino-2-(3,5-dimethoxypyrazin-2-yl)-1-methoxypentan-2-ol |
| SMILES | COCC(O)(CCCN)c1ncc(OC)nc1OC |
| InChI | InChI=1S/C12H21N3O4/c1-17-8-12(16,5-4-6-13)10-11(19-3)15-9(18-2)7-14-10/h7,16H,4-6,8,13H2,1-3H3 |
| InChIKey | YMPUFYBOIZQMIL-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |