C18H24N4O2 — CID 103392953
benzyl N-[3-(3-imidazol-1-ylpropylamino)cyclobutyl]carbamate (PubChem CID 103392953) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is benzyl N-[3-(3-imidazol-1-ylpropylamino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(3-imidazol-1-ylpropylamino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103392953 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | benzyl N-[3-(3-imidazol-1-ylpropylamino)cyclobutyl]carbamate |
| SMILES | O=C(NC1CC(NCCCn2ccnc2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C18H24N4O2/c23-18(24-13-15-5-2-1-3-6-15)21-17-11-16(12-17)20-7-4-9-22-10-8-19-14-22/h1-3,5-6,8,10,14,16-17,20H,4,7,9,11-13H2,(H,21,23) |
| InChIKey | HHJICKUKFFPSSA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|