C15H23N3O4S — CID 103393346
benzyl N-[3-(3-sulfamoylpropylamino)cyclobutyl]carbamate (PubChem CID 103393346) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is benzyl N-[3-(3-sulfamoylpropylamino)cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-(3-sulfamoylpropylamino)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103393346 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | benzyl N-[3-(3-sulfamoylpropylamino)cyclobutyl]carbamate |
| SMILES | NS(=O)(=O)CCCNC1CC(NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C15H23N3O4S/c16-23(20,21)8-4-7-17-13-9-14(10-13)18-15(19)22-11-12-5-2-1-3-6-12/h1-3,5-6,13-14,17H,4,7-11H2,(H,18,19)(H2,16,20,21) |
| InChIKey | BTWXCGJOYILKAC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|