C19H25N3O2S — CID 103393709
benzyl N-[3-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]cyclobutyl]carbamate (PubChem CID 103393709) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is benzyl N-[3-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]cyclobutyl]carbamate.
| Compound Name | benzyl N-[3-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 103393709 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | benzyl N-[3-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]cyclobutyl]carbamate |
| SMILES | CCc1cnc(C(C)NC2CC(NC(=O)OCc3ccccc3)C2)s1 |
| InChI | InChI=1S/C19H25N3O2S/c1-3-17-11-20-18(25-17)13(2)21-15-9-16(10-15)22-19(23)24-12-14-7-5-4-6-8-14/h4-8,11,13,15-16,21H,3,9-10,12H2,1-2H3,(H,22,23) |
| InChIKey | FGRXBPSAECUAMS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |