C20H25CoN2O2- — CID 10339852
butane;cobalt;(6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 10339852) has the molecular formula C20H25CoN2O2- and a molecular weight of 384.36 g/mol. Its IUPAC name is butane;cobalt;(6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | butane;cobalt;(6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 10339852 |
| Molecular Formula | C20H25CoN2O2- |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | butane;cobalt;(6Z)-6-[[2-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=C/C1=C/NCCN/C=C1/C=CC=CC1=O.[CH2-]CCC.[Co] |
| InChI | InChI=1S/C16H16N2O2.C4H9.Co/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;1-3-4-2;/h1-8,11-12,17-18H,9-10H2;1,3-4H2,2H3;/q;-1;/b13-11-,14-12-;; |
| InChIKey | OLQNWWQYCYIAEA-MVGPTFNUSA-N |
| XLogP | 2.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|