C14H19N3O2S — CID 103400001
N-tert-butyl-3-(3,5-dimethoxyphenyl)-1,2,4-thiadiazol-5-amine (PubChem CID 103400001) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-tert-butyl-3-(3,5-dimethoxyphenyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-tert-butyl-3-(3,5-dimethoxyphenyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 103400001 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-tert-butyl-3-(3,5-dimethoxyphenyl)-1,2,4-thiadiazol-5-amine |
| SMILES | COc1cc(OC)cc(-c2nsc(NC(C)(C)C)n2)c1 |
| InChI | InChI=1S/C14H19N3O2S/c1-14(2,3)16-13-15-12(17-20-13)9-6-10(18-4)8-11(7-9)19-5/h6-8H,1-5H3,(H,15,16,17) |
| InChIKey | HFIYGRSLEARHNX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |