C23H28ClNO2 — CID 10340085
3-phenylpropyl 2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetate (PubChem CID 10340085) has the molecular formula C23H28ClNO2 and a molecular weight of 385.94 g/mol. Its IUPAC name is 3-phenylpropyl 2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetate.
| Compound Name | 3-phenylpropyl 2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetate |
|---|---|
| PubChem CID | 10340085 |
| Molecular Formula | C23H28ClNO2 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 3-phenylpropyl 2-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]acetate |
| SMILES | CN1CC[C@H](c2ccc(Cl)cc2)[C@@H](CC(=O)OCCCc2ccccc2)C1 |
| InChI | InChI=1S/C23H28ClNO2/c1-25-14-13-22(19-9-11-21(24)12-10-19)20(17-25)16-23(26)27-15-5-8-18-6-3-2-4-7-18/h2-4,6-7,9-12,20,22H,5,8,13-17H2,1H3/t20-,22+/m0/s1 |
| InChIKey | HXKOFQYJBUCYAA-RBBKRZOGSA-N |
| XLogP | 4.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|