C18H23N5O5 — CID 10340279
7-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(prop-2-enoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-aminopyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 10340279) has the molecular formula C18H23N5O5 and a molecular weight of 389.41 g/mol. Its IUPAC name is 7-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(prop-2-enoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-aminopyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 7-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(prop-2-enoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-aminopyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10340279 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 7-[(3aR,4R,6R,6aR)-2,2-dimethyl-6-(prop-2-enoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-aminopyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | C=CCOC[C@H]1O[C@@H](n2cc(C(N)=O)c3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H23N5O5/c1-4-5-25-7-10-12-13(28-18(2,3)27-12)17(26-10)23-6-9(15(20)24)11-14(19)21-8-22-16(11)23/h4,6,8,10,12-13,17H,1,5,7H2,2-3H3,(H2,20,24)(H2,19,21,22)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | QSYRYBRKRCDMMV-CNEMSGBDSA-N |
| XLogP | 0.73 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|