C12H15ClN2OS — CID 103403503
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(3-chloro-4-methylthiophen-2-yl)methanone (PubChem CID 103403503) has the molecular formula C12H15ClN2OS and a molecular weight of 270.78 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(3-chloro-4-methylthiophen-2-yl)methanone.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(3-chloro-4-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 103403503 |
| Molecular Formula | C12H15ClN2OS |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(3-chloro-4-methylthiophen-2-yl)methanone |
| SMILES | Cc1csc(C(=O)N2CC[C@H]3CNC[C@H]32)c1Cl |
| InChI | InChI=1S/C12H15ClN2OS/c1-7-6-17-11(10(7)13)12(16)15-3-2-8-4-14-5-9(8)15/h6,8-9,14H,2-5H2,1H3/t8-,9+/m0/s1 |
| InChIKey | OJMUBXPBFZSKKR-DTWKUNHWSA-N |
| XLogP | 2.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |