C11H14ClN3S2 — CID 103406729
3-[5-(3-chloro-4-methylthiophen-2-yl)-1,3,4-thiadiazol-2-yl]-N-methylpropan-1-amine (PubChem CID 103406729) has the molecular formula C11H14ClN3S2 and a molecular weight of 287.84 g/mol. Its IUPAC name is 3-[5-(3-chloro-4-methylthiophen-2-yl)-1,3,4-thiadiazol-2-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[5-(3-chloro-4-methylthiophen-2-yl)-1,3,4-thiadiazol-2-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 103406729 |
| Molecular Formula | C11H14ClN3S2 |
| Molecular Weight | 287.84 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3-[5-(3-chloro-4-methylthiophen-2-yl)-1,3,4-thiadiazol-2-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCc1nnc(-c2scc(C)c2Cl)s1 |
| InChI | InChI=1S/C11H14ClN3S2/c1-7-6-16-10(9(7)12)11-15-14-8(17-11)4-3-5-13-2/h6,13H,3-5H2,1-2H3 |
| InChIKey | WGJQLYIZKBKLMD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.84 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|