C15H19ClFN3S — CID 81448764
N-[3-[5-(2-chloro-3-fluorophenyl)-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine (PubChem CID 81448764) has the molecular formula C15H19ClFN3S and a molecular weight of 327.86 g/mol. Its IUPAC name is N-[3-[5-(2-chloro-3-fluorophenyl)-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-[5-(2-chloro-3-fluorophenyl)-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 81448764 |
| Molecular Formula | C15H19ClFN3S |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[3-[5-(2-chloro-3-fluorophenyl)-1,3,4-thiadiazol-2-yl]propyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCCCc1nnc(-c2cccc(F)c2Cl)s1 |
| InChI | InChI=1S/C15H19ClFN3S/c1-10(2)9-18-8-4-7-13-19-20-15(21-13)11-5-3-6-12(17)14(11)16/h3,5-6,10,18H,4,7-9H2,1-2H3 |
| InChIKey | URGLURHTNIKEEL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|