C16H23N3S2 — CID 79212726
2-methyl-N-[3-[5-(4-methylsulfanylphenyl)-1,3,4-thiadiazol-2-yl]propyl]propan-1-amine (PubChem CID 79212726) has the molecular formula C16H23N3S2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 2-methyl-N-[3-[5-(4-methylsulfanylphenyl)-1,3,4-thiadiazol-2-yl]propyl]propan-1-amine.
| Compound Name | 2-methyl-N-[3-[5-(4-methylsulfanylphenyl)-1,3,4-thiadiazol-2-yl]propyl]propan-1-amine |
|---|---|
| PubChem CID | 79212726 |
| Molecular Formula | C16H23N3S2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-methyl-N-[3-[5-(4-methylsulfanylphenyl)-1,3,4-thiadiazol-2-yl]propyl]propan-1-amine |
| SMILES | CSc1ccc(-c2nnc(CCCNCC(C)C)s2)cc1 |
| InChI | InChI=1S/C16H23N3S2/c1-12(2)11-17-10-4-5-15-18-19-16(21-15)13-6-8-14(20-3)9-7-13/h6-9,12,17H,4-5,10-11H2,1-3H3 |
| InChIKey | HZRWJRDSDFEDDB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|