C15H19N3S2 — CID 79206259
N-[3-[5-(4-methylsulfanylphenyl)-1,3,4-thiadiazol-2-yl]propyl]cyclopropanamine (PubChem CID 79206259) has the molecular formula C15H19N3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is N-[3-[5-(4-methylsulfanylphenyl)-1,3,4-thiadiazol-2-yl]propyl]cyclopropanamine.
| Compound Name | N-[3-[5-(4-methylsulfanylphenyl)-1,3,4-thiadiazol-2-yl]propyl]cyclopropanamine |
|---|---|
| PubChem CID | 79206259 |
| Molecular Formula | C15H19N3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[3-[5-(4-methylsulfanylphenyl)-1,3,4-thiadiazol-2-yl]propyl]cyclopropanamine |
| SMILES | CSc1ccc(-c2nnc(CCCNC3CC3)s2)cc1 |
| InChI | InChI=1S/C15H19N3S2/c1-19-13-8-4-11(5-9-13)15-18-17-14(20-15)3-2-10-16-12-6-7-12/h4-5,8-9,12,16H,2-3,6-7,10H2,1H3 |
| InChIKey | VNTDSNNQLNQQGF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|