C13H15FN4S — CID 104786721
N-[3-[5-(5-fluoro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]propyl]cyclopropanamine (PubChem CID 104786721) has the molecular formula C13H15FN4S and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[3-[5-(5-fluoro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]propyl]cyclopropanamine.
| Compound Name | N-[3-[5-(5-fluoro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]propyl]cyclopropanamine |
|---|---|
| PubChem CID | 104786721 |
| Molecular Formula | C13H15FN4S |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | N-[3-[5-(5-fluoro-3-pyridinyl)-1,3,4-thiadiazol-2-yl]propyl]cyclopropanamine |
| SMILES | Fc1cncc(-c2nnc(CCCNC3CC3)s2)c1 |
| InChI | InChI=1S/C13H15FN4S/c14-10-6-9(7-15-8-10)13-18-17-12(19-13)2-1-5-16-11-3-4-11/h6-8,11,16H,1-5H2 |
| InChIKey | MKEUMSPAXQJNCR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|