C13H12BrCl2NS — CID 103407295
2-(4-bromo-2-chlorophenyl)-1-(3-chloro-4-methylthiophen-2-yl)ethanamine (PubChem CID 103407295) has the molecular formula C13H12BrCl2NS and a molecular weight of 365.12 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenyl)-1-(3-chloro-4-methylthiophen-2-yl)ethanamine.
| Compound Name | 2-(4-bromo-2-chlorophenyl)-1-(3-chloro-4-methylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 103407295 |
| Molecular Formula | C13H12BrCl2NS |
| Molecular Weight | 365.12 g/mol |
| Exact Mass | 362.93 |
| IUPAC Name | 2-(4-bromo-2-chlorophenyl)-1-(3-chloro-4-methylthiophen-2-yl)ethanamine |
| SMILES | Cc1csc(C(N)Cc2ccc(Br)cc2Cl)c1Cl |
| InChI | InChI=1S/C13H12BrCl2NS/c1-7-6-18-13(12(7)16)11(17)4-8-2-3-9(14)5-10(8)15/h2-3,5-6,11H,4,17H2,1H3 |
| InChIKey | RYKZMSWHMXNIAA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.12 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |