C12H10Br2ClNS — CID 105038039
2-(4-bromo-2-chlorophenyl)-1-(3-bromothiophen-2-yl)ethanamine (PubChem CID 105038039) has the molecular formula C12H10Br2ClNS and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenyl)-1-(3-bromothiophen-2-yl)ethanamine.
| Compound Name | 2-(4-bromo-2-chlorophenyl)-1-(3-bromothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 105038039 |
| Molecular Formula | C12H10Br2ClNS |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 392.86 |
| IUPAC Name | 2-(4-bromo-2-chlorophenyl)-1-(3-bromothiophen-2-yl)ethanamine |
| SMILES | NC(Cc1ccc(Br)cc1Cl)c1sccc1Br |
| InChI | InChI=1S/C12H10Br2ClNS/c13-8-2-1-7(10(15)6-8)5-11(16)12-9(14)3-4-17-12/h1-4,6,11H,5,16H2 |
| InChIKey | DTIRWIQGLGIXDW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |