C10H23NO5S — CID 103407365
3-[3-(2-methoxyethoxy)propoxy]-2-methylpropane-1-sulfonamide (PubChem CID 103407365) has the molecular formula C10H23NO5S and a molecular weight of 269.36 g/mol. Its IUPAC name is 3-[3-(2-methoxyethoxy)propoxy]-2-methylpropane-1-sulfonamide.
| Compound Name | 3-[3-(2-methoxyethoxy)propoxy]-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 103407365 |
| Molecular Formula | C10H23NO5S |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 3-[3-(2-methoxyethoxy)propoxy]-2-methylpropane-1-sulfonamide |
| SMILES | COCCOCCCOCC(C)CS(N)(=O)=O |
| InChI | InChI=1S/C10H23NO5S/c1-10(9-17(11,12)13)8-16-5-3-4-15-7-6-14-2/h10H,3-9H2,1-2H3,(H2,11,12,13) |
| InChIKey | QZHCXXUUDYZYFI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|