C11H25NO5S — CID 166760831
(2S)-1-[2-(2-methoxyethoxy)ethoxy]-3,3-dimethylbutane-2-sulfonamide (PubChem CID 166760831) has the molecular formula C11H25NO5S and a molecular weight of 283.39 g/mol. Its IUPAC name is (2S)-1-[2-(2-methoxyethoxy)ethoxy]-3,3-dimethylbutane-2-sulfonamide.
| Compound Name | (2S)-1-[2-(2-methoxyethoxy)ethoxy]-3,3-dimethylbutane-2-sulfonamide |
|---|---|
| PubChem CID | 166760831 |
| Molecular Formula | C11H25NO5S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (2S)-1-[2-(2-methoxyethoxy)ethoxy]-3,3-dimethylbutane-2-sulfonamide |
| SMILES | COCCOCCOC[C@H](C(C)(C)C)S(N)(=O)=O |
| InChI | InChI=1S/C11H25NO5S/c1-11(2,3)10(18(12,13)14)9-17-8-7-16-6-5-15-4/h10H,5-9H2,1-4H3,(H2,12,13,14)/t10-/m1/s1 |
| InChIKey | YARBLTRSEVWKKQ-SNVBAGLBSA-N |
| XLogP | 0.37 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|