C10H11ClN2OS — CID 103408000
(3-chloro-4-methylthiophen-2-yl)-(2-methylpyrazol-3-yl)methanol (PubChem CID 103408000) has the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. Its IUPAC name is (3-chloro-4-methylthiophen-2-yl)-(2-methylpyrazol-3-yl)methanol.
| Compound Name | (3-chloro-4-methylthiophen-2-yl)-(2-methylpyrazol-3-yl)methanol |
|---|---|
| PubChem CID | 103408000 |
| Molecular Formula | C10H11ClN2OS |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | (3-chloro-4-methylthiophen-2-yl)-(2-methylpyrazol-3-yl)methanol |
| SMILES | Cc1csc(C(O)c2ccnn2C)c1Cl |
| InChI | InChI=1S/C10H11ClN2OS/c1-6-5-15-10(8(6)11)9(14)7-3-4-12-13(7)2/h3-5,9,14H,1-2H3 |
| InChIKey | OQFYVTSUVUZLSM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |