C12H21N3O4 — CID 103408444
6-[3-(2-methoxyethoxy)propoxy]-2-(methoxymethyl)pyrimidin-4-amine (PubChem CID 103408444) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is 6-[3-(2-methoxyethoxy)propoxy]-2-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 6-[3-(2-methoxyethoxy)propoxy]-2-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 103408444 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 6-[3-(2-methoxyethoxy)propoxy]-2-(methoxymethyl)pyrimidin-4-amine |
| SMILES | COCCOCCCOc1cc(N)nc(COC)n1 |
| InChI | InChI=1S/C12H21N3O4/c1-16-6-7-18-4-3-5-19-12-8-10(13)14-11(15-12)9-17-2/h8H,3-7,9H2,1-2H3,(H2,13,14,15) |
| InChIKey | JTMMPRJCVAQOKC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|