C13H23N3O3 — CID 82456727
N-tert-butyl-6-(2-methoxyethoxy)-2-(methoxymethyl)pyrimidin-4-amine (PubChem CID 82456727) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is N-tert-butyl-6-(2-methoxyethoxy)-2-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | N-tert-butyl-6-(2-methoxyethoxy)-2-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 82456727 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | N-tert-butyl-6-(2-methoxyethoxy)-2-(methoxymethyl)pyrimidin-4-amine |
| SMILES | COCCOc1cc(NC(C)(C)C)nc(COC)n1 |
| InChI | InChI=1S/C13H23N3O3/c1-13(2,3)16-10-8-12(19-7-6-17-4)15-11(14-10)9-18-5/h8H,6-7,9H2,1-5H3,(H,14,15,16) |
| InChIKey | QOZNYSWWCAYIRQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|