C13H27N3O2S — CID 103409822
2-[4-[3-(2-methoxyethoxy)propyl]piperazin-1-yl]propanethioamide (PubChem CID 103409822) has the molecular formula C13H27N3O2S and a molecular weight of 289.45 g/mol. Its IUPAC name is 2-[4-[3-(2-methoxyethoxy)propyl]piperazin-1-yl]propanethioamide.
| Compound Name | 2-[4-[3-(2-methoxyethoxy)propyl]piperazin-1-yl]propanethioamide |
|---|---|
| PubChem CID | 103409822 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-[4-[3-(2-methoxyethoxy)propyl]piperazin-1-yl]propanethioamide |
| SMILES | COCCOCCCN1CCN(C(C)C(N)=S)CC1 |
| InChI | InChI=1S/C13H27N3O2S/c1-12(13(14)19)16-7-5-15(6-8-16)4-3-9-18-11-10-17-2/h12H,3-11H2,1-2H3,(H2,14,19) |
| InChIKey | XWCYGMZLKMRNMT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|