2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid

C8H16O5S — CID 103411624

IUPAC2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid
SMILESCOCCOCCCS(=O)CC(=O)O
InChIInChI=1S/C8H16O5S/c1-12-4-5-13-3-2-6-14(11)7-8(9)10/h2-7H2,1H3,(H,9,10)
InChIKeyKZGCPMSRXVMLEP-UHFFFAOYSA-N
MW224.28 g/mol
LogP-0.13
Rot. Bonds9

About 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid

2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid (PubChem CID 103411624) has the molecular formula C8H16O5S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid.

Molecular Properties

Compound Name2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid
PubChem CID103411624
Molecular FormulaC8H16O5S
Molecular Weight224.28 g/mol
Exact Mass224.07
IUPAC Name2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid
SMILESCOCCOCCCS(=O)CC(=O)O
InChIInChI=1S/C8H16O5S/c1-12-4-5-13-3-2-6-14(11)7-8(9)10/h2-7H2,1H3,(H,9,10)
InChIKeyKZGCPMSRXVMLEP-UHFFFAOYSA-N
XLogP-0.13
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.28
LogP ≤ 5-0.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid?
The IUPAC name of 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid (CID 103411624) is 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid.
What is the SMILES notation for 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid?
The canonical SMILES for 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid is COCCOCCCS(=O)CC(=O)O.
What is the InChIKey of 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid?
The InChIKey is KZGCPMSRXVMLEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O5S/c1-12-4-5-13-3-2-6-14(11)7-8(9)10/h2-7H2,1H3,(H,9,10).
What are the key properties of 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid?
2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid has a molecular weight of 224.28 g/mol, XLogP of -0.13, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid is sourced from PubChem (CID 103411624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).