C8H16O5S — CID 103411624
2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid (PubChem CID 103411624) has the molecular formula C8H16O5S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid.
| Compound Name | 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid |
|---|---|
| PubChem CID | 103411624 |
| Molecular Formula | C8H16O5S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-[3-(2-methoxyethoxy)propylsulfinyl]acetic acid |
| SMILES | COCCOCCCS(=O)CC(=O)O |
| InChI | InChI=1S/C8H16O5S/c1-12-4-5-13-3-2-6-14(11)7-8(9)10/h2-7H2,1H3,(H,9,10) |
| InChIKey | KZGCPMSRXVMLEP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|