C13H17BrO5S — CID 103411648
2-bromo-5-[3-(2-methoxyethoxy)propylsulfinyl]benzoic acid (PubChem CID 103411648) has the molecular formula C13H17BrO5S and a molecular weight of 365.25 g/mol. Its IUPAC name is 2-bromo-5-[3-(2-methoxyethoxy)propylsulfinyl]benzoic acid.
| Compound Name | 2-bromo-5-[3-(2-methoxyethoxy)propylsulfinyl]benzoic acid |
|---|---|
| PubChem CID | 103411648 |
| Molecular Formula | C13H17BrO5S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 2-bromo-5-[3-(2-methoxyethoxy)propylsulfinyl]benzoic acid |
| SMILES | COCCOCCCS(=O)c1ccc(Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H17BrO5S/c1-18-6-7-19-5-2-8-20(17)10-3-4-12(14)11(9-10)13(15)16/h3-4,9H,2,5-8H2,1H3,(H,15,16) |
| InChIKey | PVWQZYDCQXHKLJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|