C6H7F3N2O3S2 — CID 103414450
2-methyl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-sulfonamide (PubChem CID 103414450) has the molecular formula C6H7F3N2O3S2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-methyl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-methyl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103414450 |
| Molecular Formula | C6H7F3N2O3S2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 2-methyl-N-(2,2,2-trifluoroethoxy)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)NOCC(F)(F)F)s1 |
| InChI | InChI=1S/C6H7F3N2O3S2/c1-4-10-2-5(15-4)16(12,13)11-14-3-6(7,8)9/h2,11H,3H2,1H3 |
| InChIKey | UPAYZKPMBVUXQU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|