C11H7Br2F2NO2 — CID 103416536
6,8-dibromo-2-(difluoromethyl)-5-methoxy-1H-quinolin-4-one (PubChem CID 103416536) has the molecular formula C11H7Br2F2NO2 and a molecular weight of 382.99 g/mol. Its IUPAC name is 6,8-dibromo-2-(difluoromethyl)-5-methoxy-1H-quinolin-4-one.
| Compound Name | 6,8-dibromo-2-(difluoromethyl)-5-methoxy-1H-quinolin-4-one |
|---|---|
| PubChem CID | 103416536 |
| Molecular Formula | C11H7Br2F2NO2 |
| Molecular Weight | 382.99 g/mol |
| Exact Mass | 380.88 |
| IUPAC Name | 6,8-dibromo-2-(difluoromethyl)-5-methoxy-1H-quinolin-4-one |
| SMILES | COc1c(Br)cc(Br)c2[nH]c(C(F)F)cc(=O)c12 |
| InChI | InChI=1S/C11H7Br2F2NO2/c1-18-10-5(13)2-4(12)9-8(10)7(17)3-6(16-9)11(14)15/h2-3,11H,1H3,(H,16,17) |
| InChIKey | HEGZWMZQEZZJDK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.99 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |