C11H6Br2N2O2 — CID 103414597
6,8-dibromo-5-methoxy-4-oxo-1H-quinoline-3-carbonitrile (PubChem CID 103414597) has the molecular formula C11H6Br2N2O2 and a molecular weight of 357.99 g/mol. Its IUPAC name is 6,8-dibromo-5-methoxy-4-oxo-1H-quinoline-3-carbonitrile.
| Compound Name | 6,8-dibromo-5-methoxy-4-oxo-1H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 103414597 |
| Molecular Formula | C11H6Br2N2O2 |
| Molecular Weight | 357.99 g/mol |
| Exact Mass | 355.88 |
| IUPAC Name | 6,8-dibromo-5-methoxy-4-oxo-1H-quinoline-3-carbonitrile |
| SMILES | COc1c(Br)cc(Br)c2[nH]cc(C#N)c(=O)c12 |
| InChI | InChI=1S/C11H6Br2N2O2/c1-17-11-7(13)2-6(12)9-8(11)10(16)5(3-14)4-15-9/h2,4H,1H3,(H,15,16) |
| InChIKey | ZVYRHNAUCQHYOI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.99 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |