C12H10N2O3 — CID 22466603
5,8-dimethoxy-4-oxo-1H-quinoline-3-carbonitrile (PubChem CID 22466603) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 5,8-dimethoxy-4-oxo-1H-quinoline-3-carbonitrile.
| Compound Name | 5,8-dimethoxy-4-oxo-1H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 22466603 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 5,8-dimethoxy-4-oxo-1H-quinoline-3-carbonitrile |
| SMILES | COc1ccc(OC)c2c(=O)c(C#N)c[nH]c12 |
| InChI | InChI=1S/C12H10N2O3/c1-16-8-3-4-9(17-2)11-10(8)12(15)7(5-13)6-14-11/h3-4,6H,1-2H3,(H,14,15) |
| InChIKey | ORBNORBNTUFCFT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |