C12H7F3N2O2 — CID 59067902
4-methoxy-3-(2,2,2-trifluoroacetyl)-1H-indole-7-carbonitrile (PubChem CID 59067902) has the molecular formula C12H7F3N2O2 and a molecular weight of 268.19 g/mol. Its IUPAC name is 4-methoxy-3-(2,2,2-trifluoroacetyl)-1H-indole-7-carbonitrile.
| Compound Name | 4-methoxy-3-(2,2,2-trifluoroacetyl)-1H-indole-7-carbonitrile |
|---|---|
| PubChem CID | 59067902 |
| Molecular Formula | C12H7F3N2O2 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 4-methoxy-3-(2,2,2-trifluoroacetyl)-1H-indole-7-carbonitrile |
| SMILES | COc1ccc(C#N)c2[nH]cc(C(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C12H7F3N2O2/c1-19-8-3-2-6(4-16)10-9(8)7(5-17-10)11(18)12(13,14)15/h2-3,5,17H,1H3 |
| InChIKey | IALVUOMAFFUINZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |