C14H16Br2N2O3 — CID 103417059
1-(2,4-dibromo-5-methoxyphenyl)-3,3-dimethyl-1,4-diazepane-2,5-dione (PubChem CID 103417059) has the molecular formula C14H16Br2N2O3 and a molecular weight of 420.10 g/mol. Its IUPAC name is 1-(2,4-dibromo-5-methoxyphenyl)-3,3-dimethyl-1,4-diazepane-2,5-dione.
| Compound Name | 1-(2,4-dibromo-5-methoxyphenyl)-3,3-dimethyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 103417059 |
| Molecular Formula | C14H16Br2N2O3 |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | 1-(2,4-dibromo-5-methoxyphenyl)-3,3-dimethyl-1,4-diazepane-2,5-dione |
| SMILES | COc1cc(N2CCC(=O)NC(C)(C)C2=O)c(Br)cc1Br |
| InChI | InChI=1S/C14H16Br2N2O3/c1-14(2)13(20)18(5-4-12(19)17-14)10-7-11(21-3)9(16)6-8(10)15/h6-7H,4-5H2,1-3H3,(H,17,19) |
| InChIKey | ZEGLJYAPRAZVMB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |