C22H30O4SSi — CID 10341987
1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]ethane-1,2-diol (PubChem CID 10341987) has the molecular formula C22H30O4SSi and a molecular weight of 418.63 g/mol. Its IUPAC name is 1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]ethane-1,2-diol.
| Compound Name | 1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 10341987 |
| Molecular Formula | C22H30O4SSi |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]ethane-1,2-diol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1O[C@H](C(O)CO)CS1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30O4SSi/c1-22(2,3)28(17-10-6-4-7-11-17,18-12-8-5-9-13-18)25-15-21-26-20(16-27-21)19(24)14-23/h4-13,19-21,23-24H,14-16H2,1-3H3/t19?,20-,21+/m0/s1 |
| InChIKey | LYWPSCXNLKHNHH-GJGLBJJNSA-N |
| XLogP | 2.37 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|