C15H19N3O2S — CID 103420717
3-amino-4-methoxy-5-[methyl-[(4-methylphenyl)methyl]amino]thiophene-2-carboxamide (PubChem CID 103420717) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-amino-4-methoxy-5-[methyl-[(4-methylphenyl)methyl]amino]thiophene-2-carboxamide.
| Compound Name | 3-amino-4-methoxy-5-[methyl-[(4-methylphenyl)methyl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103420717 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-amino-4-methoxy-5-[methyl-[(4-methylphenyl)methyl]amino]thiophene-2-carboxamide |
| SMILES | COc1c(N(C)Cc2ccc(C)cc2)sc(C(N)=O)c1N |
| InChI | InChI=1S/C15H19N3O2S/c1-9-4-6-10(7-5-9)8-18(2)15-12(20-3)11(16)13(21-15)14(17)19/h4-7H,8,16H2,1-3H3,(H2,17,19) |
| InChIKey | SMWAPRMBIZWLGX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |