C15H15BrClNO4S — CID 10342114
S-[(2R,3R)-4-oxo-3-(2-oxopropyl)azetidin-2-yl] 2-(4-bromo-2-chloro-6-methylphenoxy)ethanethioate (PubChem CID 10342114) has the molecular formula C15H15BrClNO4S and a molecular weight of 420.71 g/mol. Its IUPAC name is S-[(2R,3R)-4-oxo-3-(2-oxopropyl)azetidin-2-yl] 2-(4-bromo-2-chloro-6-methylphenoxy)ethanethioate.
| Compound Name | S-[(2R,3R)-4-oxo-3-(2-oxopropyl)azetidin-2-yl] 2-(4-bromo-2-chloro-6-methylphenoxy)ethanethioate |
|---|---|
| PubChem CID | 10342114 |
| Molecular Formula | C15H15BrClNO4S |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 418.96 |
| IUPAC Name | S-[(2R,3R)-4-oxo-3-(2-oxopropyl)azetidin-2-yl] 2-(4-bromo-2-chloro-6-methylphenoxy)ethanethioate |
| SMILES | CC(=O)C[C@@H]1C(=O)N[C@@H]1SC(=O)COc1c(C)cc(Br)cc1Cl |
| InChI | InChI=1S/C15H15BrClNO4S/c1-7-3-9(16)5-11(17)13(7)22-6-12(20)23-15-10(4-8(2)19)14(21)18-15/h3,5,10,15H,4,6H2,1-2H3,(H,18,21)/t10-,15-/m1/s1 |
| InChIKey | GPEOMURMCRQBIZ-MEBBXXQBSA-N |
| XLogP | 3.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|