C26H37N3O2 — CID 10342261
4,4-dimethyl-1-[4-[propyl-[(8S)-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-yl]amino]butyl]piperidine-2,6-dione (PubChem CID 10342261) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 4,4-dimethyl-1-[4-[propyl-[(8S)-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-yl]amino]butyl]piperidine-2,6-dione.
| Compound Name | 4,4-dimethyl-1-[4-[propyl-[(8S)-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-yl]amino]butyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 10342261 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | 4,4-dimethyl-1-[4-[propyl-[(8S)-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-yl]amino]butyl]piperidine-2,6-dione |
| SMILES | CCCN(CCCCN1C(=O)CC(C)(C)CC1=O)[C@H]1CCc2ccc3[nH]ccc3c2C1 |
| InChI | InChI=1S/C26H37N3O2/c1-4-13-28(14-5-6-15-29-24(30)17-26(2,3)18-25(29)31)20-9-7-19-8-10-23-21(11-12-27-23)22(19)16-20/h8,10-12,20,27H,4-7,9,13-18H2,1-3H3/t20-/m0/s1 |
| InChIKey | GMWZSACWHHMURD-FQEVSTJZSA-N |
| XLogP | 4.69 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|