C27H36N4O2 — CID 14950457
8-[4-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)butyl-propylamino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-2-carbonitrile (PubChem CID 14950457) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 8-[4-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)butyl-propylamino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-2-carbonitrile.
| Compound Name | 8-[4-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)butyl-propylamino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-2-carbonitrile |
|---|---|
| PubChem CID | 14950457 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 8-[4-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)butyl-propylamino]-6,7,8,9-tetrahydro-3H-benzo[e]indole-2-carbonitrile |
| SMILES | CCCN(CCCCN1C(=O)CC(C)(C)CC1=O)C1CCc2ccc3[nH]c(C#N)cc3c2C1 |
| InChI | InChI=1S/C27H36N4O2/c1-4-11-30(12-5-6-13-31-25(32)16-27(2,3)17-26(31)33)21-9-7-19-8-10-24-23(22(19)15-21)14-20(18-28)29-24/h8,10,14,21,29H,4-7,9,11-13,15-17H2,1-3H3 |
| InChIKey | KVMRAZYLDHPBOZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|