C10H14N2O3S2 — CID 103424191
[3-amino-5-(methylamino)-4-methylsulfonylthiophen-2-yl]-cyclopropylmethanone (PubChem CID 103424191) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is [3-amino-5-(methylamino)-4-methylsulfonylthiophen-2-yl]-cyclopropylmethanone.
| Compound Name | [3-amino-5-(methylamino)-4-methylsulfonylthiophen-2-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 103424191 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | [3-amino-5-(methylamino)-4-methylsulfonylthiophen-2-yl]-cyclopropylmethanone |
| SMILES | CNc1sc(C(=O)C2CC2)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C10H14N2O3S2/c1-12-10-9(17(2,14)15)6(11)8(16-10)7(13)5-3-4-5/h5,12H,3-4,11H2,1-2H3 |
| InChIKey | XDHQVUFVTMFQTH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |