C14H22N2O2S — CID 103426599
ethyl 3-amino-5-[(4-methylcyclohexyl)amino]thiophene-2-carboxylate (PubChem CID 103426599) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is ethyl 3-amino-5-[(4-methylcyclohexyl)amino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-5-[(4-methylcyclohexyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103426599 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | ethyl 3-amino-5-[(4-methylcyclohexyl)amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC2CCC(C)CC2)cc1N |
| InChI | InChI=1S/C14H22N2O2S/c1-3-18-14(17)13-11(15)8-12(19-13)16-10-6-4-9(2)5-7-10/h8-10,16H,3-7,15H2,1-2H3 |
| InChIKey | JCVFVJVYGRSZHR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |